7279-75-6 Usage
Uses
Used in Pharmaceutical Industry:
4-[1-HYDROXY-2-([1-METHYLETHYL]AMINO)BUTYL]-1,2-BENZENEDIOL METHANESULFONATE is used as a β-adrenergic receptor agonist for treating respiratory conditions such as asthma and chronic obstructive pulmonary disease (COPD). Its agonist activity helps to relax the smooth muscles in the airways, leading to improved lung function and reduced symptoms.
Used in Drug Metabolism Regulation:
As a pregnane X receptor (PXR) activator, 4-[1-HYDROXY-2-([1-METHYLETHYL]AMINO)BUTYL]-1,2-BENZENEDIOL METHANESULFONATE is used to upregulate the expression of cytochrome P450 (CYP450) enzymes. This can enhance the metabolism and clearance of various drugs, potentially reducing the risk of drug-drug interactions and improving overall drug safety.
Check Digit Verification of cas no
The CAS Registry Mumber 7279-75-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,2,7 and 9 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 7279-75:
(6*7)+(5*2)+(4*7)+(3*9)+(2*7)+(1*5)=126
126 % 10 = 6
So 7279-75-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H21NO3.CH4O3S/c1-4-10(14-8(2)3)13(17)9-5-6-11(15)12(16)7-9;1-5(2,3)4/h5-8,10,13-17H,4H2,1-3H3;1H3,(H,2,3,4)
