72939-79-8 Usage
General Description
The chemical "2 4-DI-3-GUAIAZULENYL-1 3-DIHYDROXYCYCL&" is a complex organic compound with a molecular structure containing guaiazulene and dihydroxycyclohexane groups. Guaiazulene is a blue, aromatic hydrocarbon derived from chamomile oil, while dihydroxycyclohexane is a six-membered ring compound with two hydroxyl groups. This chemical likely possesses unique properties due to its complex structure, and may have applications in fields such as medicinal chemistry, organic synthesis, or materials science. Further research and analysis would be needed to fully understand the potential uses and properties of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 72939-79-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,9,3 and 9 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 72939-79:
(7*7)+(6*2)+(5*9)+(4*3)+(3*9)+(2*7)+(1*9)=168
168 % 10 = 8
So 72939-79-8 is a valid CAS Registry Number.
InChI:InChI=1/C34H36O2/c1-17(2)23-11-9-19(5)29-25(15-23)21(7)13-27(29)31-33(35)32(34(31)36)28-14-22(8)26-16-24(18(3)4)12-10-20(6)30(26)28/h9-18,31,35H,1-8H3/q+1/p-1