72987-59-8 Usage
Physical state
Colorless, odorless liquid A liquid substance that lacks color and smell, making it difficult to detect without chemical analysis.
Usage as an intermediate
Synthesis of pharmaceuticals and agrochemicals This compound serves as a starting material or building block in the production of various drugs and chemicals used in agriculture.
Employment as a solvent
Industrial processes It is used to dissolve other substances in certain industrial applications, aiding in chemical reactions or material processing.
Production method
Reaction of 2-(4-methylphenoxy)ethanol with 2-bromoethylbenzene The compound is formed by reacting these two specific starting materials, which involves a chemical reaction between an alcohol and a brominated aromatic compound.
Potential applications
Medicine, agriculture, and materials science Due to its unique chemical structure and properties, this compound may have various uses in these fields, possibly leading to new discoveries or advancements.
Unique chemical structure
2-(4-methylphenoxy)-1-(2-phenylethoxy)ethanol The compound's structure features an ethanol backbone with distinct phenoxy and phenylethoxy groups, which contribute to its special properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 72987-59-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,9,8 and 7 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 72987-59:
(7*7)+(6*2)+(5*9)+(4*8)+(3*7)+(2*5)+(1*9)=178
178 % 10 = 8
So 72987-59-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H20O3/c1-14-7-9-16(10-8-14)20-13-17(18)19-12-11-15-5-3-2-4-6-15/h2-10,17-18H,11-13H2,1H3
