73003-40-4 Usage
Chemical class
Sesquiterpene derivative
Explanation
Different sources of media describe the Explanation of 73003-40-4 differently. You can refer to the following data:
1. It is a derivative of azulene, a bicyclic sesquiterpene known for its blue color.
2. The compound has a modified azulene structure with eight hydrogen atoms and four methyl groups at various positions on the azulene ring.
3. The compound has a hydroxyl group (-OH) attached at the 5 position of the azulene ring.
4. The compound consists of 15 carbon atoms, 26 hydrogen atoms, and one oxygen atom.
5. The compound may have potential uses in these fields, but further research is needed to explore its potential applications.
6. The solubility of the compound is not mentioned in the provided material.
7. The stability of the compound under various conditions is not mentioned in the provided material.
8. The reactivity of the compound with other chemicals or under different conditions is not mentioned in the provided material.
9. The color of the compound is not mentioned in the provided material, but it is derived from azulene, which is known for its blue color.
10. The odor of the compound is not mentioned in the provided material.
Structure
Octahydro-alpha,alpha,3,8-tetramethylazulene
Functional group
Hydroxyl group
Potential applications
Organic synthesis and medicinal chemistry
Solubility
Unknown
Stability
Unknown
Reactivity
Unknown
Color
Unknown
Odor
Unknown
Check Digit Verification of cas no
The CAS Registry Mumber 73003-40-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,0,0 and 3 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 73003-40:
(7*7)+(6*3)+(5*0)+(4*0)+(3*3)+(2*4)+(1*0)=84
84 % 10 = 4
So 73003-40-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H20O/c1-9-3-5-11(8-14)7-13-10(2)4-6-12(9)13/h3,6,10-11,13-14H,4-5,7-8H2,1-2H3/t10-,11-,13-/m1/s1
