73027-05-1 Usage
Description
Doridosine is an alkaloid compound that is isolated from Anisodoris nobilis. It forms colorless rods from methanol and is laevorotatory with a specific rotation of [a]D^-66.2° (c 0.42 MeOH). Its structure has been established through chemical and spectroscopic analysis.
Uses
Used in Pharmaceutical Industry:
Doridosine is used as a pharmaceutical compound for its potential therapeutic properties. It has been studied for its potential applications in treating various diseases and conditions due to its unique chemical structure and properties.
Used in Research and Development:
Doridosine is also used as a research compound for further investigation of its chemical properties, potential applications, and mechanisms of action. This can lead to the development of new drugs and therapies based on its structure and activity.
Check Digit Verification of cas no
The CAS Registry Mumber 73027-05-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,0,2 and 7 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 73027-05:
(7*7)+(6*3)+(5*0)+(4*2)+(3*7)+(2*0)+(1*5)=101
101 % 10 = 1
So 73027-05-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H17N5O5/c1-15-8(12)5-9(14-11(15)20)16(3-13-5)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,9-10,17-19H,2,12H2,1H3,(H,14,20)/t4-,6-,7-,9?,10-/m1/s1
