7306-67-4 Usage
Uses
Used in Pharmaceutical Research:
9-(oxan-2-yl)purin-6-amine is used as a research tool for studying the structure and function of purine-based molecules in biological systems. Its resemblance to adenine allows it to be utilized in the investigation of nucleic acid metabolism and the development of new drugs targeting purine-related pathways.
Used in Drug Development:
Due to its potential biological activities, 9-(oxan-2-yl)purin-6-amine is used as a lead compound in the development of new pharmaceuticals. Its unique structure may offer novel mechanisms of action for treating various diseases, particularly those involving nucleic acid metabolism or purine-related disorders.
Used in Biochemical Studies:
9-(oxan-2-yl)purin-6-amine serves as a valuable compound in biochemical research, where it can be employed to probe the interactions between purine derivatives and enzymes, receptors, or other biomolecules. This can lead to a better understanding of the molecular mechanisms underlying purine-related biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 7306-67-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,3,0 and 6 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 7306-67:
(6*7)+(5*3)+(4*0)+(3*6)+(2*6)+(1*7)=94
94 % 10 = 4
So 7306-67-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H13N5O/c11-9-8-10(13-5-12-9)15(6-14-8)7-3-1-2-4-16-7/h5-7H,1-4H2,(H2,11,12,13)
