730964-63-3 Usage
Uses
Used in Pharmaceutical Industry:
3-Fluorophenethylisocyanide is used as a key intermediate in the synthesis of pharmaceuticals for its ability to improve the reactivity and selectivity of the compounds being developed. Its presence in the molecular structure can lead to enhanced drug properties, such as increased potency or selectivity for specific biological targets.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Fluorophenethylisocyanide is utilized as a building block for the creation of new pesticides or herbicides. Its unique chemical properties allow for the design of more effective and targeted agrochemicals, contributing to improved crop protection and yield.
Used in Organic Synthesis:
3-Fluorophenethylisocyanide is employed as a versatile reagent in organic synthesis, where it contributes to the formation of a wide range of organic compounds. Its fluorine atom plays a crucial role in the reactions, often increasing the synthetic efficiency and providing access to molecules with specific properties.
Used in Organometallic Chemistry:
As a ligand in transition metal catalyzed reactions, 3-Fluorophenethylisocyanide is instrumental in organometallic chemistry. It aids in the development of catalytic systems that are essential for various organic transformations, thus expanding the scope of synthetic methodologies available to chemists.
Check Digit Verification of cas no
The CAS Registry Mumber 730964-63-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,3,0,9,6 and 4 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 730964-63:
(8*7)+(7*3)+(6*0)+(5*9)+(4*6)+(3*4)+(2*6)+(1*3)=173
173 % 10 = 3
So 730964-63-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H8FN/c1-11-6-5-8-3-2-4-9(10)7-8/h2-4,7H,5-6H2
