731812-03-6 Usage
Description
4-(3-IODOBENZYL)MORPHOLINE is an organic chemical compound that serves as a versatile intermediate in the synthesis of pharmaceuticals. It is a morpholine derivative featuring a substituted benzyl group with an iodine atom, which endows it with unique structural and reactive properties. 4-(3-IODOBENZYL)MORPHOLINE is instrumental in the creation of a wide array of chemical entities with diverse pharmaceutical applications, including its potential use in agrochemicals and materials science.
Uses
Used in Pharmaceutical Industry:
4-(3-IODOBENZYL)MORPHOLINE is used as a key intermediate in the synthesis of various drugs, such as antihistamines, antipsychotics, and antihypertensive medications. Its unique structure and reactivity contribute to the development of these medications by facilitating the formation of complex molecular architectures that can target specific biological pathways.
Used in Agrochemical Industry:
In the agrochemical sector, 4-(3-IODOBENZYL)MORPHOLINE is utilized as a building block for the development of new agrochemicals. Its versatile properties and functional groups allow for the creation of compounds that can be used in crop protection and other agricultural applications, enhancing crop yield and quality.
Used in Materials Science:
4-(3-IODOBENZYL)MORPHOLINE also finds applications in materials science, where its unique properties can be leveraged to develop new materials with specific characteristics. These materials could have uses in various industries, including electronics, coatings, and adhesives, where novel properties such as improved conductivity, adhesion, or stability are desired.
Check Digit Verification of cas no
The CAS Registry Mumber 731812-03-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,3,1,8,1 and 2 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 731812-03:
(8*7)+(7*3)+(6*1)+(5*8)+(4*1)+(3*2)+(2*0)+(1*3)=136
136 % 10 = 6
So 731812-03-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H14INO/c12-11-3-1-2-10(8-11)9-13-4-6-14-7-5-13/h1-3,8H,4-7,9H2