7319-47-3 Usage
General Description
Pyrido(2,3-d)pyrimidine, 2,4-diamino-6-sec-butyl-5-methyl- is a chemical compound that belongs to the pyrimidine class of organic compounds. It is a derivative of pyrido(2,3-d)pyrimidine with a sec-butyl and methyl substituent attached to the 2 and 5 positions, respectively. Pyrido(2,3-d)pyrimidine, 2,4-diamino-6-sec-butyl-5-methyl- is commonly used in the pharmaceutical industry for its potential biological activities. Studies suggest that it may exhibit antitumor properties, making it a potentially important molecule for cancer research. Additionally, it may have other pharmacological uses due to its unique chemical structure and properties. Further research is needed to fully understand the potential applications and implications of this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 7319-47-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,3,1 and 9 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 7319-47:
(6*7)+(5*3)+(4*1)+(3*9)+(2*4)+(1*7)=103
103 % 10 = 3
So 7319-47-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H17N5/c1-4-6(2)8-5-15-11-9(7(8)3)10(13)16-12(14)17-11/h5-6H,4H2,1-3H3,(H4,13,14,15,16,17)