73253-30-2 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
5,7-DICHLORO-1,2,3,4-TETRAHYDRO-QUINOLINE HYDROCHLORIDE is used as a building block or intermediate for the synthesis of various compounds in the pharmaceutical industry. Its specific properties and potential applications are determined by its molecular structure and chemical reactivity, making it a valuable tool in the development of new drugs and treatments.
Used in Synthesis of Medications:
In the pharmaceutical industry, 5,7-DICHLORO-1,2,3,4-TETRAHYDRO-QUINOLINE HYDROCHLORIDE is used as a key intermediate in the synthesis of potential medications. Its unique molecular structure and chemical reactivity contribute to the creation of new and effective drug candidates for various therapeutic areas.
Used in Chemical Compound Development:
5,7-DICHLORO-1,2,3,4-TETRAHYDRO-QUINOLINE HYDROCHLORIDE is utilized as a chemical compound in the development of new compounds with specific properties and applications. Its versatility in chemical reactions allows researchers to explore its potential in various fields, including material science, agrochemicals, and other industries that require novel chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 73253-30-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,2,5 and 3 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 73253-30:
(7*7)+(6*3)+(5*2)+(4*5)+(3*3)+(2*3)+(1*0)=112
112 % 10 = 2
So 73253-30-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H9Cl2N.ClH/c10-6-4-8(11)7-2-1-3-12-9(7)5-6;/h4-5,12H,1-3H2;1H
