73287-55-5 Usage
Molecular structure
2-(4-bromo-3-hydroxy-2-quinolyl)-N,N-diethyl-2,3-dihydro-1,3-dioxo-1H-indene-5-carboxamide is a complex organic compound with multiple functional groups.
Quinoline ring
The compound contains a quinoline ring, which is a heterocyclic aromatic compound with a 4-bromo substituent and a 3-hydroxyl group.
Indene ring
The compound also features an indene ring, which is a tricyclic aromatic compound with a five-membered and a six-membered ring.
Carboxamide group
The presence of a carboxamide group (-CONH2) indicates that the compound has amide and carboxylic acid functional groups.
Diethyl-dihydro-dioxo
The compound is described as a diethyl-dihydro-dioxo compound, which means it contains two ethyl groups (-CH2CH3), a dihydro group (a two-carbon saturated hydrocarbon group), and two carbonyl groups (C=O).
Potential applications
Due to its complex structure and potential reactivity, the compound may have diverse applications in pharmaceuticals, organic synthesis, and material science.
Drug discovery and development
The compound may be utilized in drug discovery and development processes, as its complex structure could lead to the creation of new and effective medications.
New materials with unique properties
The compound could also be used in the production of new materials with unique properties, such as high stability, conductivity, or optical characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 73287-55-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,2,8 and 7 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 73287-55:
(7*7)+(6*3)+(5*2)+(4*8)+(3*7)+(2*5)+(1*5)=145
145 % 10 = 5
So 73287-55-5 is a valid CAS Registry Number.
InChI:InChI=1/C23H19BrN2O4/c1-3-26(4-2)23(30)12-9-10-13-15(11-12)21(28)17(20(13)27)19-22(29)18(24)14-7-5-6-8-16(14)25-19/h5-11,17,29H,3-4H2,1-2H3