7335-17-3 Usage
Uses
Used in Chemical Industry:
3,5-DIMETHYL-4-OCTANONE is used as a solvent for facilitating various chemical reactions, providing a medium that allows for the efficient mixing and interaction of reactants.
Used in Fragrance and Flavor Production:
3,5-DIMETHYL-4-OCTANONE is used as a key component in the production of fragrances and flavors, contributing to the unique scents and tastes of various consumer products.
Used in Organic Compound Synthesis:
3,5-DIMETHYL-4-OCTANONE serves as an intermediate in the synthesis of other organic compounds, playing a crucial role in the creation of a wide range of chemical products.
Used in Essential Oils:
3,5-DIMETHYL-4-OCTANONE is found in some natural sources, such as essential oils, where it contributes to the overall aroma and therapeutic properties of the oil.
Check Digit Verification of cas no
The CAS Registry Mumber 7335-17-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,3,3 and 5 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 7335-17:
(6*7)+(5*3)+(4*3)+(3*5)+(2*1)+(1*7)=93
93 % 10 = 3
So 7335-17-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H20O/c1-5-7-9(4)10(11)8(3)6-2/h8-9H,5-7H2,1-4H3
