73355-43-8 Usage
General Description
The chemical (4,7-diacetyloxy-2-chloro-3-formyl-6-methyl-1H-indol-5-yl) acetate is an organic compound with a complex molecular structure. It contains acetyl, chloro, formyl, methyl, and indolyl functional groups. (4,7-diacetyloxy-2-chloro-3-formyl-6-methyl-1H-indol-5-yl) acetate is likely to have pharmaceutical or industrial applications due to its unique structure, which may impact its reactivity and biological properties. Its acetyl and formyl groups suggest potential for chemical reactions, while its indolyl moiety indicates potential for interactions with biological systems. Further research and analysis would be needed to fully understand the properties and potential uses of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 73355-43-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,3,5 and 5 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 73355-43:
(7*7)+(6*3)+(5*3)+(4*5)+(3*5)+(2*4)+(1*3)=128
128 % 10 = 8
So 73355-43-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H14ClNO7/c1-6-13(23-7(2)20)12-11(10(5-19)16(17)18-12)15(25-9(4)22)14(6)24-8(3)21/h5,18H,1-4H3