73420-68-5 Usage
Uses
Used in Pharmaceutical Industry:
5-(4-Bromophenoxy)-2-furoic acid is used as an intermediate in the synthesis of pharmaceuticals for its potential to contribute to the development of new molecules with therapeutic properties. Its unique structure allows for the creation of compounds with specific biological activities, making it a valuable component in drug discovery and design.
Used in Agrochemical Industry:
In the agrochemical industry, 5-(4-Bromophenoxy)-2-furoic acid is utilized as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these products can enhance their effectiveness in controlling pests and weeds, thereby contributing to increased crop yields and agricultural productivity.
Used in Organic Chemistry Research:
5-(4-Bromophenoxy)-2-furoic acid serves as a valuable building block in organic chemistry research, enabling the development of novel molecules with potential applications in various fields. Its unique structure allows for the exploration of new chemical reactions and the synthesis of innovative compounds with diverse properties and functions.
Used as a Reagent in Organic Synthesis:
5-(4-Bromophenoxy)-2-furoic acid can be employed as a reagent in organic synthesis processes, facilitating the formation of desired products through specific chemical reactions. Its presence in a reaction mixture can influence the outcome, leading to the production of new compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 73420-68-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,4,2 and 0 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 73420-68:
(7*7)+(6*3)+(5*4)+(4*2)+(3*0)+(2*6)+(1*8)=115
115 % 10 = 5
So 73420-68-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H7BrO4/c12-7-1-3-8(4-2-7)15-10-6-5-9(16-10)11(13)14/h1-6H,(H,13,14)
73420-68-5Relevant academic research and scientific papers
SYNTHESIS AND PROPERTIES OF 5-PHENOXYFURANCARBOXYLIC ACIDS
Knoppova, Viera,Beno, Anton,Kovac, Jaroslav
, p. 910 - 913 (2007/10/02)
Furancarboxylic acids were prepared by oxidation with Ag2O of the corresponding 5-(X-phenoxy)-2-furaldehydes (X= 4-OCH3, 4-SCH3, 3-NHCOCH3, 4-Cl, 4-Br, 4-COOC2H5, 3-NO2, and 4-NO2).The appearing pKa values of the synthesized acids were determin
