73437-03-3 Usage
Uses
Used in Pharmaceutical Synthesis:
5-Amino-3-methyl-1,2-benzisothiazole serves as a crucial building block in the synthesis of pharmaceuticals, contributing to the development of biologically active molecules. Its structural features make it a valuable component in creating new drugs with potential therapeutic applications.
Used in Organic Chemistry Reactions:
As a reagent, 5-Amino-3-methyl-1,2-benzisothiazole plays a significant role in various organic chemistry reactions. Its presence can facilitate or enhance the synthesis processes, leading to the production of desired compounds with specific properties.
Used in Drug Development:
Due to its pharmacological properties and biological activities, 5-Amino-3-methyl-1,2-benzisothiazole holds promise for the development of new drugs. Its potential applications span across different therapeutic areas, offering opportunities for innovation in medicinal chemistry.
Used in Agrochemical Development:
5-Amino-3-methyl-1,2-benzisothiazole also shows potential in the agrochemical industry. Its use in the development of new agrochemicals could lead to the creation of more effective and targeted products for agricultural applications, enhancing crop protection and yield.
Check Digit Verification of cas no
The CAS Registry Mumber 73437-03-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,4,3 and 7 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 73437-03:
(7*7)+(6*3)+(5*4)+(4*3)+(3*7)+(2*0)+(1*3)=123
123 % 10 = 3
So 73437-03-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N2S/c1-5-7-4-6(9)2-3-8(7)11-10-5/h2-4H,9H2,1H3
73437-03-3Relevant academic research and scientific papers
PROCESS FOR THE PREPARATION OF 6-(PERFLUOROALKYL)URACIL COMPOUNDS FROM CARBAMATE COMPOUNDS
-
Page 23, (2010/02/06)
An improved process for the preparation of 6-(perfluoroalkyl)uracil compounds having structural formula (I) from carbamate compounds having structural formula (II).
Substituent Interaction with Ring Sulfur in some Heterocyclic Compounds
McKinnon, David M.,Abouzeid, A. A.
, p. 749 - 752 (2007/10/02)
The infrared carbonyl absorptions of 7-acetyl-1,2-benzisothiazoles are similar to 7-acetylbenzothiophenes, but are lower by approximately 15 cm-1 than the corresponding benzofurans.The reasons for this are discussed.
