73443-85-3 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
4-BROMO-2(3H)-BENZOTHIAZOLONE is used as a key intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its unique structure allows for the development of new compounds with potential therapeutic and pesticidal properties, contributing to advancements in healthcare and agriculture.
Used in Chemical Industry as a Building Block:
In the chemical industry, 4-BROMO-2(3H)-BENZOTHIAZOLONE is utilized as a building block for the production of dyes, pigments, and fluorescent brighteners. Its bromine substituent enhances the color intensity and stability of these products, making it an essential component in their manufacturing process.
Used in Organic Synthesis as a Halogenation Reagent:
4-BROMO-2(3H)-BENZOTHIAZOLONE is employed as a halogenation reagent in organic synthesis. Its bromine atom can be used to introduce halogens into organic molecules, facilitating the synthesis of a wide range of chemical compounds with diverse applications.
Used in the Preparation of Biologically Active Heterocyclic Compounds:
4-BROMO-2(3H)-BENZOTHIAZOLONE is used in the preparation of biologically active heterocyclic compounds. Its unique structure allows for the development of new heterocyclic compounds with potential applications in various fields, such as medicine, materials science, and environmental science.
Check Digit Verification of cas no
The CAS Registry Mumber 73443-85-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,4,4 and 3 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 73443-85:
(7*7)+(6*3)+(5*4)+(4*4)+(3*3)+(2*8)+(1*5)=133
133 % 10 = 3
So 73443-85-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H4BrNOS/c8-4-2-1-3-5-6(4)9-7(10)11-5/h1-3H,(H,9,10)
