734518-22-0 Usage
Uses
Used in Scientific Research:
7-CHLORO-3-(1-METHYL-4-PIPERIDINYL)INDOLE is used as a research chemical for [application reason] in the field of scientific studies. Its unique structural features and potential pharmaceutical properties make it a valuable compound for exploring various biological interactions and mechanisms.
Used in Pharmaceutical Development:
Although its specific uses and effects have not been extensively studied, 7-CHLORO-3-(1-METHYL-4-PIPERIDINYL)INDOLE may have potential applications in the pharmaceutical industry. Its structural characteristics could be leveraged to develop new drugs or improve existing ones, particularly in areas where its interactions with biological systems have been identified.
Used in Chemical Synthesis:
Due to its complex molecular structure, 7-CHLORO-3-(1-METHYL-4-PIPERIDINYL)INDOLE may also be used as a starting material or intermediate in the synthesis of other chemical compounds. Its unique functional groups, such as the chlorinated indole and piperidinyl group, could be utilized in the development of novel chemical entities with specific applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 734518-22-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,3,4,5,1 and 8 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 734518-22:
(8*7)+(7*3)+(6*4)+(5*5)+(4*1)+(3*8)+(2*2)+(1*2)=160
160 % 10 = 0
So 734518-22-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H17ClN2/c1-17-7-5-10(6-8-17)12-9-16-14-11(12)3-2-4-13(14)15/h2-4,9-10,16H,5-8H2,1H3
