73456-99-2 Usage
Uses
Used in Pharmaceutical Industry:
3-Amino-3-furan-2-yl-propionic acid is used as a potential drug candidate for various therapeutic applications due to its unique structure and potential biological activity. Its specific role in medicine may include targeting specific diseases or conditions, although the exact applications are subject to ongoing research and development.
Used in Chemical Synthesis:
In the field of chemical synthesis, 3-Amino-3-furan-2-yl-propionic acid serves as a valuable building block for the creation of complex molecules and pharmaceuticals. Its unique structural features make it a versatile component in the development of new compounds with diverse applications.
Used in Agricultural Applications:
3-Amino-3-furan-2-yl-propionic acid may also find use in agriculture, potentially serving as a component in the development of new agrochemicals or as a tool in the study of plant biology and interactions.
Used in Material Science:
In material science, the compound's unique properties could be harnessed for the development of new materials with specific characteristics, such as improved stability, reactivity, or other desirable traits in various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 73456-99-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,4,5 and 6 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 73456-99:
(7*7)+(6*3)+(5*4)+(4*5)+(3*6)+(2*9)+(1*9)=152
152 % 10 = 2
So 73456-99-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO3/c8-5(4-7(9)10)6-2-1-3-11-6/h1-3,5H,4,8H2,(H,9,10)
73456-99-2Relevant academic research and scientific papers
Competitive formation of β-amino acids, propenoic, and ylidenemalonic acids by the Rodionov reaction from malonic acid, aldehydes, and ammonium acetate in alcoholic medium
Lebedev,Lebedeva,Sheludyakov,Kovaleva,Ustinova,Kozhevnikov
, p. 1113 - 1124 (2007/10/03)
The Rodionov reaction of 49 available aliphatic and aromatic aldehydes with malonic acid and ammonium acetate in alcoholic medium, resulting in formation of β-amino acids, propenoic, and ylidenemalonic acids, was studied. Certain regioselectivity regularities of the reaction were revealed. Among the variety of ketones studied, cyclohexanone is the only whose reaction yields a β-amino acid. Unusual dehydrofluorination of 6-chloro-2-fluorocinnamic acid under the Rodionov reaction was discovered. 2005 Pleiades Publishing, Inc.
