73522-72-2 Usage
Properties
1. Chemical name: 2-Amino-1,2,5-trideoxy-3-O-(2,6-diamino-2,3,4,6-tetradeoxy-α-D-erythro-hexopyranosyl)-6-O-methyl-5-(methylamino)-D-chiro-inositol
2. Common name: Gentamicin
3. Classification: Aminoglycoside antibiotic
4. Mechanism of action: Inhibits protein synthesis in bacteria
5. Usage: Treats bacterial infections
6. Components: Aminoglycoside, amino sugars, methyl groups
7. Clinical application: Treats infections caused by gram-negative and certain gram-positive bacteria
8. Risks and side effects: Kidney damage, hearing loss
Specific content
Gentamicin is a complex molecule with multiple components.
It works by stopping bacterial growth and proliferation through protein synthesis inhibition.
Used in clinical settings for various bacterial infections caused by specific bacteria.
Potential risks and side effects include kidney damage and hearing loss.
Requires medical supervision and caution during use.
Check Digit Verification of cas no
The CAS Registry Mumber 73522-72-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,5,2 and 2 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 73522-72:
(7*7)+(6*3)+(5*5)+(4*2)+(3*2)+(2*7)+(1*2)=122
122 % 10 = 2
So 73522-72-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H30N4O4/c1-18-11-10(20-2)5-9(17)13(12(11)19)22-14-8(16)4-3-7(6-15)21-14/h7-14,18-19H,3-6,15-17H2,1-2H3
