73536-87-5 Usage
General Description
2-Amino-5-nitroindan hydrochloride is an organic compound with the molecular formula C9H9ClN2O2. It is a derivative of the indane class of organic compounds and consists of a nitro group and an amino group attached to the carbon atoms of the indane ring. 2-AMINO-5-NITROINDAN HYDROCHLORIDE is often used as a precursor in the synthesis of pharmaceuticals and agrochemicals. Additionally, it has been studied for its potential biological and pharmacological properties, including its potential as an antitumor and antibacterial agent. Its hydrochloride salt form enhances its solubility in aqueous solutions, making it easier to handle and use in various applications. Overall, 2-amino-5-nitroindan hydrochloride is a versatile chemical with potential uses in the pharmaceutical and agricultural industries.
Check Digit Verification of cas no
The CAS Registry Mumber 73536-87-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,5,3 and 6 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 73536-87:
(7*7)+(6*3)+(5*5)+(4*3)+(3*6)+(2*8)+(1*7)=145
145 % 10 = 5
So 73536-87-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O2.ClH/c10-8-3-6-1-2-9(11(12)13)5-7(6)4-8;/h1-2,5,8H,3-4,10H2;1H
