7356-61-8 Usage
Uses
Used in Pharmaceutical Industry:
Ethyl 4-amino-2-methoxypyrimidine-5-carboxylate is used as an intermediate in the synthesis of pharmaceuticals for its potential anti-inflammatory and antitumor properties. Its ability to modulate biological activities makes it a valuable building block in the development of new drugs.
Used in Agrochemical Industry:
Ethyl 4-amino-2-methoxypyrimidine-5-carboxylate is also used as an intermediate in the synthesis of agrochemicals, contributing to the development of new pesticides or other agricultural products that can improve crop yield and protect against various pathogens.
Used in Chemical Research and Development:
As a versatile building block in organic synthesis, ethyl 4-amino-2-methoxypyrimidine-5-carboxylate serves as a valuable intermediate for chemical research and development. Its unique structure and properties allow scientists to explore its potential applications in various chemical reactions and the creation of novel compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 7356-61-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,3,5 and 6 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 7356-61:
(6*7)+(5*3)+(4*5)+(3*6)+(2*6)+(1*1)=108
108 % 10 = 8
So 7356-61-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H11N3O3/c1-3-14-7(12)5-4-10-8(13-2)11-6(5)9/h4H,3H2,1-2H3,(H2,9,10,11)
