736173-14-1 Usage
Property
Different sources of media describe the Property of 736173-14-1 differently. You can refer to the following data:
1. Belongs to the group of chemicals known as naphthalenols
2. Contains an amine group attached to a naphthalene ring
3. Contains a nitrophenyl group
4. Used in pharmaceutical research and drug development as a precursor for synthesis
5. Potential applications in the treatment of certain diseases or conditions
6. Further research and studies needed
Content
Different sources of media describe the Content of 736173-14-1 differently. You can refer to the following data:
1. 2-[amino-(3-nitro-phenyl)-methyl]-naphthalen-1-ol
2. Hydrochloride salt form
Check Digit Verification of cas no
The CAS Registry Mumber 736173-14-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,3,6,1,7 and 3 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 736173-14:
(8*7)+(7*3)+(6*6)+(5*1)+(4*7)+(3*3)+(2*1)+(1*4)=161
161 % 10 = 1
So 736173-14-1 is a valid CAS Registry Number.
InChI:InChI=1/C17H14N2O3.ClH/c18-16(12-5-3-6-13(10-12)19(21)22)15-9-8-11-4-1-2-7-14(11)17(15)20;/h1-10,16,20H,18H2;1H
