73622-55-6 Usage
Uses
Used in Agricultural Industry:
[(2,4-Dichlorophenyl)sulfinyl]acetic acid is used as a herbicide for controlling grass weeds in different types of crops. It functions by inhibiting the production of fatty acids in the weeds, which ultimately leads to their death. As a selective herbicide, it targets specific types of plants while leaving others unharmed, making it a preferred choice for weed control in agricultural settings.
Additionally, Diclofop-methyl is known for its low toxicity to mammals and the environment, contributing to its popularity as a safe and effective herbicide in modern agriculture.
Check Digit Verification of cas no
The CAS Registry Mumber 73622-55-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,6,2 and 2 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 73622-55:
(7*7)+(6*3)+(5*6)+(4*2)+(3*2)+(2*5)+(1*5)=126
126 % 10 = 6
So 73622-55-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H6Cl2O3S/c9-5-1-2-7(6(10)3-5)14(13)4-8(11)12/h1-3H,4H2,(H,11,12)
