73637-04-4 Usage
Uses
Used in Dye and Pigment Industry:
2,4-bis(2-methylphenoxy)aniline is used as a chemical intermediate for the synthesis of dyes and pigments, contributing to the production of various colorants used in different applications.
Used in Pharmaceutical Industry:
2,4-bis(2-methylphenoxy)aniline is used as a building block in the development of pharmaceutical compounds, playing a crucial role in the synthesis of certain drugs.
It is important to take proper precautions when handling 2,4-bis(2-methylphenoxy)aniline to avoid potential health hazards and ensure its safe use in various applications. Additionally, proper management and disposal of this chemical are necessary to minimize its environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 73637-04-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,6,3 and 7 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 73637-04:
(7*7)+(6*3)+(5*6)+(4*3)+(3*7)+(2*0)+(1*4)=134
134 % 10 = 4
So 73637-04-4 is a valid CAS Registry Number.
InChI:InChI=1/C20H19NO2/c1-14-7-3-5-9-18(14)22-16-11-12-17(21)20(13-16)23-19-10-6-4-8-15(19)2/h3-13H,21H2,1-2H3