73663-75-9 Usage
Description
[4-[cyano(4-fluorophenyl)methyl]phenyl]ammonium chloride is a complex organic chemical compound that features a quaternary ammonium cation and a chloride anion. The cationic component is characterized by a substituted benzyl group, which includes a cyano group and a 4-fluorophenyl group, all connected to a central phenyl group. This molecular structure is relatively large and intricate, offering a wide range of potential applications in various chemical processes.
Uses
Used in Laboratory Research:
[4-[cyano(4-fluorophenyl)methyl]phenyl]ammonium chloride is utilized as a reactant, catalyst, or intermediate in laboratory research. Its unique molecular structure allows it to participate in a variety of chemical reactions, making it a valuable tool for scientists exploring new compounds and reaction pathways.
Used in Synthesis Processes:
In the field of chemical synthesis, [4-[cyano(4-fluorophenyl)methyl]phenyl]ammonium chloride serves as a key component in the creation of new organic compounds. Its versatility in reacting with other molecules can lead to the development of pharmaceuticals, materials, and other specialty chemicals.
Used in Chemical Reactions:
The specific uses of [4-[cyano(4-fluorophenyl)methyl]phenyl]ammonium chloride in chemical reactions can vary widely, depending on the desired outcome and the nature of the reaction. Its complex structure and the presence of functional groups such as the cyano and 4-fluorophenyl groups make it suitable for a range of applications, from organic synthesis to catalysis.
Used in Pharmaceutical Development:
Given its potential reactivity and structural complexity, [4-[cyano(4-fluorophenyl)methyl]phenyl]ammonium chloride may also find use in the development of pharmaceuticals. Its ability to interact with other molecules could lead to the creation of new drug candidates or the improvement of existing medications.
Used in Material Science:
In material science, [4-[cyano(4-fluorophenyl)methyl]phenyl]ammonium chloride could be employed to develop new materials with unique properties. Its participation in chemical reactions could lead to the formation of novel polymers, coatings, or other materials with specific characteristics for various applications.
Each of these uses highlights the versatility and potential of [4-[cyano(4-fluorophenyl)methyl]phenyl]ammonium chloride in the field of chemistry. Its complex molecular structure and reactivity make it a promising candidate for further research and development in a variety of industries.
Check Digit Verification of cas no
The CAS Registry Mumber 73663-75-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,6,6 and 3 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 73663-75:
(7*7)+(6*3)+(5*6)+(4*6)+(3*3)+(2*7)+(1*5)=149
149 % 10 = 9
So 73663-75-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H11FN2/c15-12-5-1-10(2-6-12)14(9-16)11-3-7-13(17)8-4-11/h1-8,14H,17H2
