73663-77-1 Usage
Uses
Used in Organic Synthesis:
[4-[cyano(p-tolyl)methyl]phenyl]ammonium chloride is used as a reagent in organic synthesis for its ability to facilitate the formation of new chemical bonds and the synthesis of complex organic molecules. The presence of the cyano group makes it a valuable component in the creation of a wide range of organic compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, [4-[cyano(p-tolyl)methyl]phenyl]ammonium chloride is used as an intermediate in the synthesis of various drugs. Its unique structure allows it to be a key component in the development of new medications, contributing to the advancement of pharmaceutical research and drug discovery.
Used in Dyes:
[4-[cyano(p-tolyl)methyl]phenyl]ammonium chloride is used as a component in the production of dyes due to its ability to impart color to various materials. Its chemical properties make it suitable for use in the creation of a diverse array of dyes for different applications.
Used as a Catalyst in Chemical Processes:
[4-[cyano(p-tolyl)methyl]phenyl]ammonium chloride also serves as a catalyst in various chemical processes, enhancing the rate of reactions and improving the efficiency of industrial chemical production. Its role as a catalyst is crucial in optimizing the outcomes of numerous chemical reactions.
Overall, [4-[cyano(p-tolyl)methyl]phenyl]ammonium chloride is a valuable chemical with a wide range of industrial and scientific applications, making it an essential component in the fields of organic synthesis, pharmaceuticals, dyes, and as a catalyst in chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 73663-77-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,6,6 and 3 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 73663-77:
(7*7)+(6*3)+(5*6)+(4*6)+(3*3)+(2*7)+(1*7)=151
151 % 10 = 1
So 73663-77-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H14N2/c1-11-2-4-12(5-3-11)15(10-16)13-6-8-14(17)9-7-13/h2-9,15H,17H2,1H3
