73688-69-4 Usage
Uses
Used in Pharmaceutical Industry:
1-ethyl-2-methyl-1H-benzimidazol-5-amine dihydrochloride is used as a potential active pharmaceutical ingredient for its potential antiparasitic, antifungal, or antiviral properties due to its benzimidazole structure, which is known for its broad-spectrum activity against various pathogens.
Used in Research and Development:
1-ethyl-2-methyl-1H-benzimidazol-5-amine dihydrochloride is used as a research compound for further investigation into its specific pharmacological effects and potential therapeutic applications, as it may offer new insights into the development of novel treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 73688-69-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,6,8 and 8 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 73688-69:
(7*7)+(6*3)+(5*6)+(4*8)+(3*8)+(2*6)+(1*9)=174
174 % 10 = 4
So 73688-69-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H13N3/c1-3-13-7(2)12-9-6-8(11)4-5-10(9)13/h4-6H,3,11H2,1-2H3
