7369-94-0 Usage
General Description
(H-CYS-TYR-OH)2 is a chemical compound made up of two molecules of the dipeptide H-CYS-TYR-OH. This dipeptide consists of two amino acids, cysteine (CYS) and tyrosine (TYR), linked together by a peptide bond. Cysteine is a sulfur-containing amino acid that plays a key role in the formation of disulfide bonds, which are important for maintaining the structure and stability of proteins. Tyrosine is a non-essential amino acid that is involved in the synthesis of neurotransmitters and hormones. As a dipeptide, H-CYS-TYR-OH is likely to have biological activities and potential therapeutic applications in the fields of medicine and biochemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 7369-94-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,3,6 and 9 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 7369-94:
(6*7)+(5*3)+(4*6)+(3*9)+(2*9)+(1*4)=130
130 % 10 = 0
So 7369-94-0 is a valid CAS Registry Number.
InChI:InChI=1/C24H30N4O8S2/c25-17(21(31)27-19(23(33)34)9-13-1-5-15(29)6-2-13)11-37-38-12-18(26)22(32)28-20(24(35)36)10-14-3-7-16(30)8-4-14/h1-8,17-20,29-30H,9-12,25-26H2,(H,27,31)(H,28,32)(H,33,34)(H,35,36)