73713-82-3 Usage
Uses
Used in Organic Synthesis:
2,3-Dihydro-3-methyl-2-(4-methylphenoxy)-1,3,2-benzothiazaphosphole 2-oxide is utilized as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for versatile chemical reactions, facilitating the creation of a wide range of molecules with different functional groups and properties.
Used in Material Science:
In the field of material science, 2,3-Dihydro-3-methyl-2-(4-methylphenoxy)-1,3,2-benzothiazaphosphole 2-oxide is employed as a component in the development of new materials with specific properties. Its incorporation into polymers, for instance, may enhance certain characteristics such as thermal stability, mechanical strength, or chemical resistance.
Used in Medicinal Chemistry:
2,3-Dihydro-3-methyl-2-(4-methylphenoxy)-1,3,2-benzothiazaphosphole 2-oxide is considered for use in medicinal chemistry, where its potential biological activities could be harnessed to develop new pharmaceutical agents. Further research is necessary to explore its interactions with biological targets and its efficacy in treating specific diseases or conditions.
Used in Agriculture:
2,3-Dihydro-3-methyl-2-(4-methylphenoxy)-1,3,2-benzothiazaphosphole 2-oxide may also find applications in agriculture, possibly as a component of pesticides or fertilizers, due to its potential biological activities. However, more research is required to determine its suitability and effectiveness in this context.
Further research is essential to fully understand the properties and potential uses of 2,3-Dihydro-3-methyl-2-(4-methylphenoxy)-1,3,2-benzothiazaphosphole 2-oxide, ensuring that its applications are developed responsibly and effectively.
Check Digit Verification of cas no
The CAS Registry Mumber 73713-82-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,7,1 and 3 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 73713-82:
(7*7)+(6*3)+(5*7)+(4*1)+(3*3)+(2*8)+(1*2)=133
133 % 10 = 3
So 73713-82-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H14NO2PS/c1-11-7-9-12(10-8-11)17-18(16)15(2)13-5-3-4-6-14(13)19-18/h3-10H,1-2H3
