737690-96-9 Usage
General Description
(5-(Pyridin-3-yl)-1,3,4-oxadiazol-2-yl)methanamine is a chemical compound with the molecular formula C8H8N4O. It is a member of the oxadiazole family, which is known for its diverse range of biological activities. This particular compound contains a pyridine ring, an oxadiazole ring, and a methanamine functional group. It may have potential applications in pharmaceutical research and drug development due to its unique structure and potential biological activities. Further research is needed to determine its specific properties and potential uses in the medical or chemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 737690-96-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,3,7,6,9 and 0 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 737690-96:
(8*7)+(7*3)+(6*7)+(5*6)+(4*9)+(3*0)+(2*9)+(1*6)=209
209 % 10 = 9
So 737690-96-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N4O/c9-4-7-11-12-8(13-7)6-2-1-3-10-5-6/h1-3,5H,4,9H2