73776-17-7 Usage
Uses
Used in Pharmaceutical Industry:
3-Quinolinecarboxylic acid, 1,2-dihydro-2-oxo-, Methyl ester is used as a pharmaceutical intermediate for the synthesis of various drugs due to its potential biological activities, including antimicrobial, antifungal, and antiviral properties. Its derivatives are being studied for their potential therapeutic effects in treating a range of diseases.
Used in Organic Synthesis:
In the field of organic synthesis, 3-Quinolinecarboxylic acid, 1,2-dihydro-2-oxo-, Methyl ester is utilized as a key building block for the creation of diverse organic compounds. Its unique structure allows for the development of new chemical entities with potential applications in various industries.
Used in Drug Development:
3-Quinolinecarboxylic acid, 1,2-dihydro-2-oxo-, Methyl ester is employed as a potential drug candidate in the pharmaceutical development process. Its derivatives are being investigated for their therapeutic potential, with the aim of discovering new treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 73776-17-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,7,7 and 6 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 73776-17:
(7*7)+(6*3)+(5*7)+(4*7)+(3*6)+(2*1)+(1*7)=157
157 % 10 = 7
So 73776-17-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H9NO3/c1-15-11(14)8-6-7-4-2-3-5-9(7)12-10(8)13/h2-6H,1H3,(H,12,13)
