73819-76-8 Usage
Uses
Used in Polymer Production:
4-Ethynylphthalic anhydride is used as a monomer for the production of polymers and copolymers, serving as a building block for the creation of polyimides, polyesters, and other high-performance materials. Its unique structure contributes to the enhanced properties of these materials, making them suitable for a range of applications.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 4-Ethynylphthalic anhydride is used as a reactant in the synthesis of various pharmaceuticals. Its reactivity and functional groups make it a valuable component in the development of new drugs and medicinal compounds.
Used in Specialty Chemicals:
4-Ethynylphthalic anhydride is also employed in the synthesis of specialty chemicals, such as dyes and other organic compounds. Its ethynyl group and anhydride functionality provide a platform for further chemical reactions, enabling the production of a diverse array of specialty products.
Environmental Considerations:
While 4-Ethynylphthalic anhydride is considered to have low acute toxicity and minimal environmental impact, it is essential to follow proper handling and disposal procedures to prevent exposure and reduce the potential for environmental contamination. This ensures the safe and responsible use of this chemical compound in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 73819-76-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,8,1 and 9 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 73819-76:
(7*7)+(6*3)+(5*8)+(4*1)+(3*9)+(2*7)+(1*6)=158
158 % 10 = 8
So 73819-76-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H4O3/c1-2-6-3-4-7-8(5-6)10(12)13-9(7)11/h1,3-5H
