73826-08-1 Usage
General Description
1-(4-Chloro-1-naphtyloxy)-2-propanone is a chemical compound that is commonly used in various industries. It is a synthetic intermediate that is utilized in the production of pharmaceuticals, agrochemicals, and other organic compounds. The chemical is known for its ability to act as a building block in the synthesis of more complex molecules, making it a valuable precursor in the manufacturing process. Additionally, 1-(4-Chloro-1-naphtyloxy)-2-propanone is also used as a research tool in laboratory settings to investigate the properties and behaviors of different chemical compounds. Overall, the chemical has a wide range of applications and is valued for its versatility and utility in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 73826-08-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,8,2 and 6 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 73826-08:
(7*7)+(6*3)+(5*8)+(4*2)+(3*6)+(2*0)+(1*8)=141
141 % 10 = 1
So 73826-08-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H11ClO2/c1-9(15)8-16-13-7-6-12(14)10-4-2-3-5-11(10)13/h2-7H,8H2,1H3
