7384-17-0 Usage
Uses
Used in Pharmaceutical Research:
3-OXO-4-INDAZOLINE CARBOXYLIC ACID is utilized as a key building block in the development of new pharmaceuticals, leveraging its unique structure to enhance the design and synthesis of therapeutic agents. Its presence in drug molecules can contribute to improved pharmacological properties, such as potency, selectivity, and bioavailability.
Used in Agrochemical Development:
In the agrochemical industry, 3-OXO-4-INDAZOLINE CARBOXYLIC ACID is employed as a fundamental component in the synthesis of novel agrochemicals. Its incorporation into these compounds can lead to the creation of more effective and targeted pest control solutions, contributing to sustainable agricultural practices.
Used in Organic Synthesis:
3-OXO-4-INDAZOLINE CARBOXYLIC ACID serves as a crucial intermediate in organic synthesis, enabling the construction of complex organic molecules with diverse applications. Its reactivity and functional group compatibility make it a preferred choice for chemists aiming to synthesize intricate molecular architectures.
Used in Biological Research:
3-OXO-4-INDAZOLINE CARBOXYLIC ACID is also applied in biological research as a tool to study various biological processes. Its unique structure allows for the exploration of molecular interactions, signaling pathways, and other biological phenomena, thereby contributing to a deeper understanding of life sciences.
Check Digit Verification of cas no
The CAS Registry Mumber 7384-17-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,3,8 and 4 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 7384-17:
(6*7)+(5*3)+(4*8)+(3*4)+(2*1)+(1*7)=110
110 % 10 = 0
So 7384-17-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H6N2O3/c11-7-6-4(8(12)13)2-1-3-5(6)9-10-7/h1-3H,(H,12,13)(H2,9,10,11)
