7384-94-3 Usage
Uses
Used in Pharmaceutical Industry:
2-[N-[2-(1H-Indol-3-yl)ethyl]-N-isopropylamino]ethanol is used as an intermediate compound for the synthesis of various pharmaceuticals. Its unique molecular structure allows it to be a key component in the development of new drugs targeting specific receptors or pathways in the body.
Used in Chemical Research:
In the field of chemical research, 2-[N-[2-(1H-Indol-3-yl)ethyl]-N-isopropylamino]ethanol serves as a valuable compound for studying the properties and reactivity of indole-based molecules. Its synthesis and modification can provide insights into the development of novel chemical entities with potential applications in various industries.
Used in Neurotransmitter Research:
As a derivative of tryptamine, 2-[N-[2-(1H-Indol-3-yl)ethyl]-N-isopropylamino]ethanol is used in the research and development of neurotransmitters. Its structure may offer potential applications in modulating neurotransmission, which could be beneficial for the treatment of various neurological disorders.
Used in Psychedelic Research:
Given its relation to tryptamine, 2-[N-[2-(1H-Indol-3-yl)ethyl]-N-isopropylamino]ethanol may also be used in the study of psychedelic compounds. Research in this area could lead to a better understanding of the effects of psychedelics on the human brain and potentially contribute to the development of new therapeutic approaches for mental health conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 7384-94-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,3,8 and 4 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 7384-94:
(6*7)+(5*3)+(4*8)+(3*4)+(2*9)+(1*4)=123
123 % 10 = 3
So 7384-94-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H22N2O/c1-12(2)17(9-10-18)8-7-13-11-16-15-6-4-3-5-14(13)15/h3-6,11-12,16,18H,7-10H2,1-2H3