73855-51-3 Usage
Properties
1. Chemical compound used in the production of polymers and resins
2. Resorcinol derivative with two chloropropyl groups and an amino-methyl group
3. Commonly used in manufacturing rubber additives, adhesives, and coatings
4. Also used in the production of fire-retardant materials
5. Serves as an intermediate in the synthesis of other organic compounds
6. May present certain hazards
Function
Component in production of polymers and resins
Structure
Resorcinol ring with two chloropropyl groups and an amino-methyl group attached
Uses
Manufacturing rubber additives, adhesives, coatings, fire-retardant materials
Intermediate
Used in synthesis of other organic compounds
Hazards
Precautions required when handling the chemical
Check Digit Verification of cas no
The CAS Registry Mumber 73855-51-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,8,5 and 5 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 73855-51:
(7*7)+(6*3)+(5*8)+(4*5)+(3*5)+(2*5)+(1*1)=153
153 % 10 = 3
So 73855-51-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H18Cl3NO2/c1-8(14)5-17(6-9(2)15)7-10-3-11(16)13(19)4-12(10)18/h3-4,8-9,18-19H,5-7H2,1-2H3
