7388-58-1 Usage
Uses
Used in Cosmetic Products:
Hexadecanamide, N-Methyl-, is used as an ingredient in cosmetic products for its emulsifying and stabilizing properties. It helps to create a smooth texture and maintain the consistency of the product, ensuring a pleasant user experience.
Used in Cleaning Emulsions:
In the cleaning industry, Hexadecanamide, N-Methyl-, is used as an emulsifier in cleaning emulsions. It aids in the formation of stable emulsions that effectively remove dirt and stains from various surfaces. Its emulsifying properties also contribute to the overall performance and effectiveness of the cleaning products.
As an Intermediate in Synthesis:
Hexadecanamide, N-Methyl-, plays a crucial role as an intermediate in the synthesis of N-Methyl-N-nitroso-1-hexadecanamine (M325190), a compound that has various applications in the cosmetic and cleaning industries. Its involvement in the synthesis process highlights its importance in the production of valuable end products.
Synthesis Reference(s)
Tetrahedron Letters, 34, p. 6215, 1993 DOI: 10.1016/S0040-4039(00)73713-0
Check Digit Verification of cas no
The CAS Registry Mumber 7388-58-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,3,8 and 8 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 7388-58:
(6*7)+(5*3)+(4*8)+(3*8)+(2*5)+(1*8)=131
131 % 10 = 1
So 7388-58-1 is a valid CAS Registry Number.
InChI:InChI=1/C17H35NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18-2/h3-16H2,1-2H3,(H,18,19)
