73883-48-4 Usage
Uses
Used in Pharmaceutical Synthesis:
2,4-Dinitropyridine monohydrochloride is used as a building block for the synthesis of various pharmaceuticals. Its unique chemical structure allows for the creation of new compounds with potential therapeutic properties, contributing to the development of novel drugs for treating various diseases and conditions.
Used in Agrochemical Synthesis:
In the agrochemical industry, 2,4-Dinitropyridine monohydrochloride is utilized as a key component in the synthesis of pesticides and other crop protection agents. Its incorporation into these products enhances their effectiveness in controlling pests and diseases, thereby improving crop yields and food security.
Used in Organic Chemistry Research:
As a reagent in organic chemistry reactions, 2,4-Dinitropyridine monohydrochloride is used for the formation of carbon-carbon bonds. This capability makes it a valuable tool in the synthesis of complex organic molecules, facilitating research and development in various fields, including materials science, polymer chemistry, and medicinal chemistry.
Used in Environmental Protection:
Proper handling, storage, and disposal of 2,4-Dinitropyridine monohydrochloride are essential to prevent environmental contamination. Its classification as a hazardous substance necessitates adherence to safety protocols and regulations, ensuring the protection of ecosystems and human health from potential harm.
Check Digit Verification of cas no
The CAS Registry Mumber 73883-48-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,8,8 and 3 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 73883-48:
(7*7)+(6*3)+(5*8)+(4*8)+(3*3)+(2*4)+(1*8)=164
164 % 10 = 4
So 73883-48-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H3N3O4.ClH/c9-7(10)4-1-2-6-5(3-4)8(11)12;/h1-3H;1H
