73953-75-0 Usage
Uses
Used in Pharmaceutical Applications:
1-(3,4-Dichlorophenyl)-3-isopropyl-3-(2-propynyl)thiourea is used as an antithyroid agent for its potential to regulate thyroid hormone levels and treat related conditions. Its ability to inhibit the growth of certain cancer cells also makes it a candidate for further research in oncology.
Used in Agricultural Applications:
In the agricultural industry, 1-(3,4-Dichlorophenyl)-3-isopropyl-3-(2-propynyl)thiourea is used as a fungicide to protect crops from fungal infections, thereby improving crop yield and quality.
Used in Chemical Research:
1-(3,4-Dichlorophenyl)-3-isopropyl-3-(2-propynyl)thiourea serves as a valuable compound for chemical research, particularly in the development of new pharmaceuticals and pesticides. Its unique molecular structure and bioactivity make it an interesting subject for further study and potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 73953-75-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,9,5 and 3 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 73953-75:
(7*7)+(6*3)+(5*9)+(4*5)+(3*3)+(2*7)+(1*5)=160
160 % 10 = 0
So 73953-75-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H14Cl2N2S/c1-4-7-17(9(2)3)13(18)16-10-5-6-11(14)12(15)8-10/h1,5-6,8-9H,7H2,2-3H3,(H,16,18)
