73987-05-0 Usage
Class of organic compounds
Amines 2-(4-Chlorophenyl)-1,3-dioxan-5-amine belongs to the amine class, which is a group of organic compounds containing a nitrogen atom with a single bond to a carbon chain.
Five-membered dioxane ring structure
The compound features a five-membered dioxane ring, which is a cyclic structure consisting of two oxygen atoms and three carbon atoms.
Chlorine-substituted phenyl group
A chlorine atom is attached to the phenyl group (a six-carbon ring with alternating single and double bonds) in the compound, specifically at the second position (ortho position).
Potential applications
Pharmaceutical and chemical industries 2-(4-Chlorophenyl)-1,3-dioxan-5-amine may be used as a building block in the synthesis of various drugs and other organic compounds, making it valuable in the development of new pharmaceuticals and chemicals.
Subject of interest for researchers and scientists
Due to its specific properties, reactivity, and potential uses, 2-(4-Chlorophenyl)-1,3-dioxan-5-amine is of interest to researchers and scientists in the field of organic chemistry, who may study its behavior and potential applications further.
Check Digit Verification of cas no
The CAS Registry Mumber 73987-05-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,9,8 and 7 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 73987-05:
(7*7)+(6*3)+(5*9)+(4*8)+(3*7)+(2*0)+(1*5)=170
170 % 10 = 0
So 73987-05-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H12ClNO2/c11-8-3-1-7(2-4-8)10-13-5-9(12)6-14-10/h1-4,9-10H,5-6,12H2
