73987-13-0 Usage
Physical form
White crystalline solid
Use in pharmaceutical industry
As a precursor for the synthesis of various drugs
Potential applications
Antifungal and antimicrobial agent
Other industries
Pesticides, perfumes, and flavorings
Chemical structure
Dioxolane ring and chlorophenyl group, which gives it unique properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 73987-13-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,9,8 and 7 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 73987-13:
(7*7)+(6*3)+(5*9)+(4*8)+(3*7)+(2*1)+(1*3)=170
170 % 10 = 0
So 73987-13-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H11ClO3/c11-8-3-1-7(2-4-8)10-13-6-9(5-12)14-10/h1-4,9-10,12H,5-6H2
