7401-30-1 Usage
Uses
Used in Pharmaceutical Synthesis:
2-(p-Chlorophenyl)-5-methyl-5-nitro-1,3-dioxane is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the creation of a wide range of medicinal compounds, contributing to the development of new drugs and therapies.
Used in Agrochemical Production:
2-(p-Chlorophenyl)-5-methyl-5-nitro-1,3-dioxane is also utilized as a building block in the production of agrochemicals, such as pesticides and herbicides. Its chemical properties make it a valuable component in the formulation of effective agricultural products.
Used in Antimicrobial Applications:
2-(p-Chlorophenyl)-5-methyl-5-nitro-1,3-dioxane has shown potential as an antimicrobial agent, making it a candidate for use in medical applications to combat bacterial infections. Its ability to inhibit microbial growth could be harnessed in the development of new antimicrobial treatments.
Used in Antiparasitic Applications:
In addition to its antimicrobial properties, 2-(p-Chlorophenyl)-5-methyl-5-nitro-1,3-dioxane has also demonstrated potential as an antiparasitic agent. This makes it a promising candidate for use in the treatment of parasitic infections, contributing to the development of new antiparasitic drugs.
Used in Research and Development:
Due to its unique chemical structure and potential applications, 2-(p-Chlorophenyl)-5-methyl-5-nitro-1,3-dioxane is used in research and development settings to explore its properties and potential uses further. This includes studying its interactions with biological systems and evaluating its efficacy in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 7401-30-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,0 and 1 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 7401-30:
(6*7)+(5*4)+(4*0)+(3*1)+(2*3)+(1*0)=71
71 % 10 = 1
So 7401-30-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H12ClNO4/c1-11(13(14)15)6-16-10(17-7-11)8-2-4-9(12)5-3-8/h2-5,10H,6-7H2,1H3
