7402-16-6 Usage
Uses
Used in Pharmaceutical Industry:
8-Amino-quinolin-6-ol is used as a pharmaceutical intermediate for its potential anti-inflammatory, anti-cancer, and antimicrobial properties. Its diverse biological activities make it a promising candidate for the development of new drugs targeting various diseases and conditions.
Used in Dye Industry:
8-Amino-quinolin-6-ol is used as a dye intermediate due to its ability to form colored compounds, which can be utilized in the production of dyes and pigments for various applications.
Used in Organic Synthesis:
8-Amino-quinolin-6-ol is used as a building block in the synthesis of organic compounds, contributing to the development of new chemical entities with potential applications in various industries.
Used in Coordination Chemistry:
8-Amino-quinolin-6-ol is used in coordination chemistry for the formation of metal complexes, which can exhibit unique properties and find applications in areas such as catalysis, sensing, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 7402-16-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,0 and 2 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 7402-16:
(6*7)+(5*4)+(4*0)+(3*2)+(2*1)+(1*6)=76
76 % 10 = 6
So 7402-16-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O/c10-8-5-7(12)4-6-2-1-3-11-9(6)8/h1-5,12H,10H2
7402-16-6Relevant academic research and scientific papers
COMPOSITIONS AND METHODS FOR TREATING AND PREVENTING CANCER
-
Page/Page column 78-80, (2016/12/12)
This invention is in the field of medicinal chemistry. In particular, the invention relates to novel small molecule compounds having a quinolin-8-yl-nicotinamide structure which are useful in treating, ameliorating, or preventing various forms of cancer (e.g., pancreatic cancer).
