7403-26-1 Usage
Uses
Used in Pharmaceutical Industry:
Pyrimido[4,5-d]pyrimidin-4(3H)-one (6CI,8CI) is used as a key intermediate in the synthesis of bioactive molecules for drug discovery and development. Its unique structure allows for the creation of compounds with potential therapeutic effects, making it a valuable component in medicinal chemistry.
Used in Drug Discovery:
Pyrimido[4,5-d]pyrimidin-4(3H)-one (6CI,8CI) serves as a structural framework for the development of new pharmaceutical agents. Its potential pharmacological activities are being explored to identify and optimize compounds that can be used for treating various diseases and conditions.
Used in Medicinal Chemistry Research:
As a heterocyclic compound with interesting structural features, Pyrimido[4,5-d]pyrimidin-4(3H)-one (6CI,8CI) is used in medicinal chemistry research to understand its interactions with biological targets and to develop new therapeutic agents based on its molecular properties.
Check Digit Verification of cas no
The CAS Registry Mumber 7403-26-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,0 and 3 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 7403-26:
(6*7)+(5*4)+(4*0)+(3*3)+(2*2)+(1*6)=81
81 % 10 = 1
So 7403-26-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H4N4O/c11-6-4-1-7-2-8-5(4)9-3-10-6/h1-3H,(H,7,8,9,10,11)
