74038-94-1 Usage
General Description
1H-Indole-3-acetic acid, 5,7-dimethyl-(9CI) is a chemical compound with the molecular formula C12H13NO2. It is a derivative of the plant hormone indole-3-acetic acid (IAA) and is a naturally occurring auxin, a class of plant growth regulators. It plays a crucial role in regulating plant growth and development, including cell elongation, root development, and fruit ripening. 1H-Indole-3-acetic acid, 5,7-dimethyl-(9CI) has been studied for its potential agricultural applications, as it may be used to control plant growth and improve crop yields. Additionally, it is also being investigated for its potential medicinal properties, including anti-inflammatory and anti-cancer effects. Overall, this chemical compound has the potential to have significant implications in both agriculture and medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 74038-94-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,0,3 and 8 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 74038-94:
(7*7)+(6*4)+(5*0)+(4*3)+(3*8)+(2*9)+(1*4)=131
131 % 10 = 1
So 74038-94-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NO2/c1-7-3-8(2)12-10(4-7)9(6-13-12)5-11(14)15/h3-4,6,13H,5H2,1-2H3,(H,14,15)
