74051-49-3 Usage
Uses
Used in Pharmaceutical Industry:
2,4(1H,3H)Pyrimidinedione, 3-[[(5-chloro-3-methylsalicyl)methylamino]methyl]is used as a pharmaceutical compound for its potential therapeutic benefits in treating various conditions. Its unique structure and properties make it a promising candidate for drug development and discovery.
Used in Medicinal Chemistry Research:
2,4(1H,3H)Pyrimidinedione, 3-[[(5-chloro-3-methylsalicyl)methylamino]methyl]is used as a research tool in medicinal chemistry to explore its properties and effects. Further investigation into its potential applications is warranted to fully understand its capabilities and maximize its benefits in the field of drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 74051-49-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,0,5 and 1 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 74051-49:
(7*7)+(6*4)+(5*0)+(4*5)+(3*1)+(2*4)+(1*9)=113
113 % 10 = 3
So 74051-49-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H16ClN3O3/c1-9-5-11(15)6-10(13(9)20)7-17(2)8-18-12(19)3-4-16-14(18)21/h3-6,20H,7-8H2,1-2H3,(H,16,21)
