74173-77-6 Usage
Uses
Used in Pharmaceutical Industry:
QUINAZOLINE, 2,4-DICHLORO-6-NITRO is used as a precursor in the production of various drugs for its ability to be synthesized into a range of medicinal compounds.
Used in Agrochemical Industry:
QUINAZOLINE, 2,4-DICHLORO-6-NITRO is also used as an intermediate in the synthesis of agrochemicals, contributing to the development of pesticides and other agricultural products.
Used in Chemical Research:
In the field of chemical research, QUINAZOLINE, 2,4-DICHLORO-6-NITRO serves as a valuable intermediate for the synthesis of complex organic molecules, facilitating the discovery and development of new chemical entities with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 74173-77-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,1,7 and 3 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 74173-77:
(7*7)+(6*4)+(5*1)+(4*7)+(3*3)+(2*7)+(1*7)=136
136 % 10 = 6
So 74173-77-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H3Cl2N3O2/c9-7-5-3-4(13(14)15)1-2-6(5)11-8(10)12-7/h1-3H
