74235-23-7 Usage
Uses
Used in Agriculture:
3-Hydroxymugineic acid is used as a plant growth regulator for enhancing the growth and development of crops. It plays a crucial role in iron uptake and transport in plants, thereby improving their overall health and productivity.
Used in Pharmaceutical Industry:
3-Hydroxymugineic acid is used as a potential therapeutic agent for various health conditions. Its unique chemical structure allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs.
Used in Environmental Applications:
3-Hydroxymugineic acid is used as an environmental remediation agent for the removal of heavy metals and other pollutants from soil and water. Its ability to chelate metal ions makes it an effective tool for addressing environmental contamination issues.
Used in Analytical Chemistry:
3-Hydroxymugineic acid is used as an analytical reagent for the detection and quantification of metal ions in various samples. Its selective binding properties enable accurate and sensitive measurements in a wide range of applications.
Check Digit Verification of cas no
The CAS Registry Mumber 74235-23-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,2,3 and 5 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 74235-23:
(7*7)+(6*4)+(5*2)+(4*3)+(3*5)+(2*2)+(1*3)=117
117 % 10 = 7
So 74235-23-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H20N2O9/c15-5(10(18)19)1-2-13-8(11(20)21)6(16)3-14-4-7(17)9(14)12(22)23/h5-9,13,15-17H,1-4H2,(H,18,19)(H,20,21)(H,22,23)/t5-,6-,7+,8-,9-/m0/s1
