7424-15-9 Usage
Uses
Used in Chemical Synthesis:
H-HIS-BETANA is used as a chemical intermediate for the synthesis of various organic compounds and pharmaceuticals. Its unique structure allows for the formation of amide bonds and other functional groups, making it a versatile building block in organic chemistry.
Used in Analytical Chemistry:
H-HIS-BETANA is used as a derivatization agent in analytical chemistry for the detection and quantification of various analytes. Its ability to form stable complexes with metal ions and other molecules makes it a useful tool for enhancing the sensitivity and selectivity of analytical methods.
Used in Pharmaceutical Industry:
H-HIS-BETANA is used as a precursor in the development of new drugs and drug candidates. Its unique chemical properties and potential interactions with biological targets make it a promising starting point for the design of novel therapeutic agents.
Used in Research and Development:
H-HIS-BETANA is used as a research tool in various scientific fields, including biochemistry, materials science, and nanotechnology. Its unique properties and potential applications make it an interesting subject for further investigation and development.
Check Digit Verification of cas no
The CAS Registry Mumber 7424-15-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,2 and 4 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 7424-15:
(6*7)+(5*4)+(4*2)+(3*4)+(2*1)+(1*5)=89
89 % 10 = 9
So 7424-15-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H16N4O/c17-15(8-14-9-18-10-19-14)16(21)20-13-6-5-11-3-1-2-4-12(11)7-13/h1-7,9-10,15H,8,17H2,(H,18,19)(H,20,21)/t15-/m0/s1
