74261-65-7 Usage
Uses
Used in Chemical Synthesis:
4-AZIDOPHENYL ISOTHIOCYANATE is used as a synthetic building block for the creation of various complex organic molecules. Its azide group allows for unique chemical reactions and modifications, making it a valuable component in the synthesis of a wide range of compounds.
Used in Surface Modification:
4-AZIDOPHENYL ISOTHIOCYANATE is used as a surface modifier for the preparation of peptide-conjugated surfaces on silicon surfaces through click chemistry. This application enables the development of advanced materials with specific properties, such as improved biocompatibility or enhanced functionality.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 4-AZIDOPHENYL ISOTHIOCYANATE is used as a key intermediate in the synthesis of kainic acid analogs, such as (2S,3S,4S)-4-[l-(4′-azido-phenyl)thioureylenernethy lethenyl]-2-carboxy-3-pyrro-lidineacetic acid. These analogs have potential applications in the development of new drugs targeting neurological disorders.
Used in Nanotechnology:
4-AZIDOPHENYL ISOTHIOCYANATE is used as a component in the development of photosensitive nanoparticles bearing azidophenyl units at their surface. These nanoparticles have potential applications in various fields, including targeted drug delivery, imaging, and sensing technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 74261-65-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,2,6 and 1 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 74261-65:
(7*7)+(6*4)+(5*2)+(4*6)+(3*1)+(2*6)+(1*5)=127
127 % 10 = 7
So 74261-65-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H4N4S/c8-11-10-7-3-1-6(2-4-7)9-5-12/h1-4H
